Seudónimo Seudónimo

01-11-2020
Chemistry

contestada

If you know what chemical group an element is in, what can you predict about its electron arrangement?

Respuesta :

markjonathan06p78e60 markjonathan06p78e60

01-11-2020

Answer:

it's atomic number reveals it's amount of electrons, each shell have a certain amount it could carry it's

2-8-8-18-18-32-32

It's called the octet rule.

Answer Link

Otras preguntas

Without actually calculating any logarithms, determine which of the following intervals the sound intensity level of a sound with intensity 3.66×10^−4W/m^2 fall

Select the correct answer. Which state of matter is highly compressible, is made of particles moving independently of each other, and is present in large quanti

A soccer player has made 3 of her last 10 field goals, which is a field goal percentage of 30%. How many more consecutive field goals would she need to make to

the dot plot above identifies the number of pets living with each of 20 families in an apartment building .what fraction of families have more than two pets

What is 10+x-15-3x please

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

What is the solution to Ax+ bx + C=0

How does this image enhance the information providedin the book?o It connects the book's central ideas about bicycleinnovators.It offers an example of how the A

characteristics of euglena

Find the number of pieces of floor tiles each measuring 26cm long and 10cm wide needed to lay a floor measuring 260m long and 15m wide